C11H6F3NO2 — CID 70210319
quinolin-3-yl 2,2,2-trifluoroacetate (PubChem CID 70210319) has the molecular formula C11H6F3NO2 and a molecular weight of 241.17 g/mol. Its IUPAC name is quinolin-3-yl 2,2,2-trifluoroacetate.
| Compound Name | quinolin-3-yl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 70210319 |
| Molecular Formula | C11H6F3NO2 |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | quinolin-3-yl 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cnc2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C11H6F3NO2/c12-11(13,14)10(16)17-8-5-7-3-1-2-4-9(7)15-6-8/h1-6H |
| InChIKey | ZTUPVSMPBJAXFL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |