C34H52N2O8P+ — CID 70210600
[2-[(2S,4S)-2-[[3-[(2R)-2-amino-3-methylbutanoyl]oxy-2,2-dimethylpropanoyl]oxymethoxycarbonyl]-4-cyclohexylpyrrolidin-1-yl]-2-oxoethyl]-oxo-(4-phenylbutyl)phosphanium (PubChem CID 70210600) has the molecular formula C34H52N2O8P+ and a molecular weight of 647.77 g/mol. Its IUPAC name is [2-[(2S,4S)-2-[[3-[(2R)-2-amino-3-methylbutanoyl]oxy-2,2-dimethylpropanoyl]oxymethoxycarbonyl]-4-cyclohexylpyrrolidin-1-yl]-2-oxoethyl]-oxo-(4-phenylbutyl)phosphanium.
| Compound Name | [2-[(2S,4S)-2-[[3-[(2R)-2-amino-3-methylbutanoyl]oxy-2,2-dimethylpropanoyl]oxymethoxycarbonyl]-4-cyclohexylpyrrolidin-1-yl]-2-oxoethyl]-oxo-(4-phenylbutyl)phosphanium |
|---|---|
| PubChem CID | 70210600 |
| Molecular Formula | C34H52N2O8P+ |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 647.35 |
| IUPAC Name | [2-[(2S,4S)-2-[[3-[(2R)-2-amino-3-methylbutanoyl]oxy-2,2-dimethylpropanoyl]oxymethoxycarbonyl]-4-cyclohexylpyrrolidin-1-yl]-2-oxoethyl]-oxo-(4-phenylbutyl)phosphanium |
| SMILES | CC(C)[C@@H](N)C(=O)OCC(C)(C)C(=O)OCOC(=O)[C@@H]1C[C@@H](C2CCCCC2)CN1C(=O)C[P+](=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C34H52N2O8P/c1-24(2)30(35)32(39)42-22-34(3,4)33(40)44-23-43-31(38)28-19-27(26-16-9-6-10-17-26)20-36(28)29(37)21-45(41)18-12-11-15-25-13-7-5-8-14-25/h5,7-8,13-14,24,26-28,30H,6,9-12,15-23,35H2,1-4H3/q+1/t27-,28+,30-/m1/s1 |
| InChIKey | KBFKTLIIMCHHQC-OYKXOOMRSA-N |
| XLogP | 5.23 |
| TPSA | 142.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|