About [4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone
[4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone (PubChem CID 70212554) has the molecular formula C11H18N4OS
and a molecular weight of 254.36 g/mol. Its IUPAC name is [4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone.
Molecular Properties
| Compound Name | [4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone |
| PubChem CID | 70212554 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | [4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone |
| SMILES | O=C(C1NC=CS1)N1CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C11H18N4OS/c16-11(10-13-1-6-17-10)15-4-2-14(3-5-15)9-7-12-8-9/h1,6,9-10,12-13H,2-5,7-8H2 |
| InChIKey | WZDYKPOTRZBPPF-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone?
The IUPAC name of [4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone (CID 70212554) is [4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone.
What is the SMILES notation for [4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone?
The canonical SMILES for [4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone is O=C(C1NC=CS1)N1CCN(C2CNC2)CC1.
What is the InChIKey of [4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone?
The InChIKey is WZDYKPOTRZBPPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4OS/c16-11(10-13-1-6-17-10)15-4-2-14(3-5-15)9-7-12-8-9/h1,6,9-10,12-13H,2-5,7-8H2.
What are the key properties of [4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone?
[4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone has a molecular weight of 254.36 g/mol, XLogP of -0.76, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(azetidin-3-yl)piperazin-1-yl]-(2,3-dihydro-1,3-thiazol-2-yl)methanone is sourced from PubChem (CID 70212554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).