About 7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid
7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid (PubChem CID 70213280) has the molecular formula C10H14N2O4
and a molecular weight of 226.23 g/mol. Its IUPAC name is 7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| PubChem CID | 70213280 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| SMILES | CC12C=CC(C(C(=O)O)C1C(=O)O)C2(N)N |
| InChI | InChI=1S/C10H14N2O4/c1-9-3-2-4(10(9,11)12)5(7(13)14)6(9)8(15)16/h2-6H,11-12H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | RDKZIUORGLHXHZ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid?
The IUPAC name of 7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid (CID 70213280) is 7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid.
What is the SMILES notation for 7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid?
The canonical SMILES for 7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid is CC12C=CC(C(C(=O)O)C1C(=O)O)C2(N)N.
What is the InChIKey of 7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid?
The InChIKey is RDKZIUORGLHXHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4/c1-9-3-2-4(10(9,11)12)5(7(13)14)6(9)8(15)16/h2-6H,11-12H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid?
7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid has a molecular weight of 226.23 g/mol, XLogP of -0.79, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-diamino-1-methylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid is sourced from PubChem (CID 70213280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).