C21H38O5 — CID 70213423
(1R,3S,4R,5R)-4-(7,8-dihydroxyoct-2-enyl)-5-[(3S)-3-hydroxyoct-1-enyl]cyclopentane-1,3-diol (PubChem CID 70213423) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is (1R,3S,4R,5R)-4-(7,8-dihydroxyoct-2-enyl)-5-[(3S)-3-hydroxyoct-1-enyl]cyclopentane-1,3-diol.
| Compound Name | (1R,3S,4R,5R)-4-(7,8-dihydroxyoct-2-enyl)-5-[(3S)-3-hydroxyoct-1-enyl]cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 70213423 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | (1R,3S,4R,5R)-4-(7,8-dihydroxyoct-2-enyl)-5-[(3S)-3-hydroxyoct-1-enyl]cyclopentane-1,3-diol |
| SMILES | CCCCC[C@H](O)C=C[C@@H]1[C@@H](CC=CCCCC(O)CO)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C21H38O5/c1-2-3-6-9-16(23)12-13-19-18(20(25)14-21(19)26)11-8-5-4-7-10-17(24)15-22/h5,8,12-13,16-26H,2-4,6-7,9-11,14-15H2,1H3/t16-,17?,18+,19+,20-,21+/m0/s1 |
| InChIKey | VNTDVZNCXNTXKS-DTUSPMKXSA-N |
| XLogP | 2.31 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|