C19H17NO — CID 70213917
3-(1,2,3,4-tetrahydronaphthalen-2-ylmethylidene)-1H-indol-2-one (PubChem CID 70213917) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-(1,2,3,4-tetrahydronaphthalen-2-ylmethylidene)-1H-indol-2-one.
| Compound Name | 3-(1,2,3,4-tetrahydronaphthalen-2-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 70213917 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-(1,2,3,4-tetrahydronaphthalen-2-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2C1=CC1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H17NO/c21-19-17(16-7-3-4-8-18(16)20-19)12-13-9-10-14-5-1-2-6-15(14)11-13/h1-8,12-13H,9-11H2,(H,20,21) |
| InChIKey | JPYQCYJBBMGCBJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|