C40H56BrN5O4Si2 — CID 70214450
ethyl 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]spiro[2.5]octane-2-carboxylate (PubChem CID 70214450) has the molecular formula C40H56BrN5O4Si2 and a molecular weight of 806.99 g/mol. Its IUPAC name is ethyl 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]spiro[2.5]octane-2-carboxylate.
| Compound Name | ethyl 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]spiro[2.5]octane-2-carboxylate |
|---|---|
| PubChem CID | 70214450 |
| Molecular Formula | C40H56BrN5O4Si2 |
| Molecular Weight | 806.99 g/mol |
| Exact Mass | 805.31 |
| IUPAC Name | ethyl 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]spiro[2.5]octane-2-carboxylate |
| SMILES | CCOC(=O)C1CC12CCC(c1nc3c(-c4ccc(-c5ccccc5)nc4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c1Br)CC2 |
| InChI | InChI=1S/C40H56BrN5O4Si2/c1-8-50-39(47)33-24-40(33)18-16-30(17-19-40)36-35(41)38(45(27-48-20-22-51(2,3)4)28-49-21-23-52(5,6)7)46-37(44-36)32(26-43-46)31-14-15-34(42-25-31)29-12-10-9-11-13-29/h9-15,25-26,30,33H,8,16-24,27-28H2,1-7H3 |
| InChIKey | NNFBORYZIYDDDQ-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 91.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.99 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|