About dimethyl cyclobutane-1,1-dicarboxylate
dimethyl cyclobutane-1,1-dicarboxylate (PubChem CID 7021469) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is dimethyl cyclobutane-1,1-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl cyclobutane-1,1-dicarboxylate |
| PubChem CID | 7021469 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | dimethyl cyclobutane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CCC1 |
| InChI | InChI=1S/C8H12O4/c1-11-6(9)8(4-3-5-8)7(10)12-2/h3-5H2,1-2H3 |
| InChIKey | KIFHUHBBUBVJNH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl cyclobutane-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl cyclobutane-1,1-dicarboxylate?
The IUPAC name of dimethyl cyclobutane-1,1-dicarboxylate (CID 7021469) is dimethyl cyclobutane-1,1-dicarboxylate.
What is the SMILES notation for dimethyl cyclobutane-1,1-dicarboxylate?
The canonical SMILES for dimethyl cyclobutane-1,1-dicarboxylate is COC(=O)C1(C(=O)OC)CCC1.
What is the InChIKey of dimethyl cyclobutane-1,1-dicarboxylate?
The InChIKey is KIFHUHBBUBVJNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-11-6(9)8(4-3-5-8)7(10)12-2/h3-5H2,1-2H3.
What are the key properties of dimethyl cyclobutane-1,1-dicarboxylate?
dimethyl cyclobutane-1,1-dicarboxylate has a molecular weight of 172.18 g/mol, XLogP of 0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl cyclobutane-1,1-dicarboxylate is sourced from PubChem (CID 7021469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).