methyl 2-(2-methylphenyl)acetate

C10H12O2 — CID 7021479

IUPACmethyl 2-(2-methylphenyl)acetate
SMILESCOC(=O)Cc1ccccc1C
InChIInChI=1S/C10H12O2/c1-8-5-3-4-6-9(8)7-10(11)12-2/h3-6H,7H2,1-2H3
InChIKeyBLEMRRXGTKTJGT-UHFFFAOYSA-N
MW164.20 g/mol
LogP1.71
Rot. Bonds2

About methyl 2-(2-methylphenyl)acetate

methyl 2-(2-methylphenyl)acetate (PubChem CID 7021479) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is methyl 2-(2-methylphenyl)acetate.

Molecular Properties

Compound Namemethyl 2-(2-methylphenyl)acetate
PubChem CID7021479
Molecular FormulaC10H12O2
Molecular Weight164.20 g/mol
Exact Mass164.08
IUPAC Namemethyl 2-(2-methylphenyl)acetate
SMILESCOC(=O)Cc1ccccc1C
InChIInChI=1S/C10H12O2/c1-8-5-3-4-6-9(8)7-10(11)12-2/h3-6H,7H2,1-2H3
InChIKeyBLEMRRXGTKTJGT-UHFFFAOYSA-N
XLogP1.71
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.20
LogP ≤ 51.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 2-(2-methylphenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2-methylphenyl)acetate?
The IUPAC name of methyl 2-(2-methylphenyl)acetate (CID 7021479) is methyl 2-(2-methylphenyl)acetate.
What is the SMILES notation for methyl 2-(2-methylphenyl)acetate?
The canonical SMILES for methyl 2-(2-methylphenyl)acetate is COC(=O)Cc1ccccc1C.
What is the InChIKey of methyl 2-(2-methylphenyl)acetate?
The InChIKey is BLEMRRXGTKTJGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-8-5-3-4-6-9(8)7-10(11)12-2/h3-6H,7H2,1-2H3.
What are the key properties of methyl 2-(2-methylphenyl)acetate?
methyl 2-(2-methylphenyl)acetate has a molecular weight of 164.20 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-methylphenyl)acetate is sourced from PubChem (CID 7021479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).