About benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate
benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate (PubChem CID 7021513) has the molecular formula C13H14N2O4
and a molecular weight of 262.26 g/mol. Its IUPAC name is benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate |
| PubChem CID | 7021513 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate |
| SMILES | O=C1CC[C@H](NC(=O)OCc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C13H14N2O4/c16-11-7-6-10(12(17)15-11)14-13(18)19-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,18)(H,15,16,17)/t10-/m0/s1 |
| InChIKey | JJFWWAGUYKLJRN-JTQLQIEISA-N |
| XLogP | 0.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate?
The IUPAC name of benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate (CID 7021513) is benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate.
What is the SMILES notation for benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate?
The canonical SMILES for benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate is O=C1CC[C@H](NC(=O)OCc2ccccc2)C(=O)N1.
What is the InChIKey of benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate?
The InChIKey is JJFWWAGUYKLJRN-JTQLQIEISA-N. The full InChI is InChI=1S/C13H14N2O4/c16-11-7-6-10(12(17)15-11)14-13(18)19-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,18)(H,15,16,17)/t10-/m0/s1.
What are the key properties of benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate?
benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate has a molecular weight of 262.26 g/mol, XLogP of 0.72, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(3S)-2,6-dioxopiperidin-3-yl]carbamate is sourced from PubChem (CID 7021513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).