About N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide
N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide (PubChem CID 7021517) has the molecular formula C8H19N3O+2
and a molecular weight of 173.26 g/mol. Its IUPAC name is N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide.
Molecular Properties
| Compound Name | N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide |
| PubChem CID | 7021517 |
| Molecular Formula | C8H19N3O+2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide |
| SMILES | CN(C)C(=O)C[NH+]1CC[NH2+]CC1 |
| InChI | InChI=1S/C8H17N3O/c1-10(2)8(12)7-11-5-3-9-4-6-11/h9H,3-7H2,1-2H3/p+2 |
| InChIKey | JJEMPZXXGBIJIX-UHFFFAOYSA-P |
| XLogP | -3.46 |
| TPSA | 41.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide?
The IUPAC name of N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide (CID 7021517) is N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide.
What is the SMILES notation for N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide?
The canonical SMILES for N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide is CN(C)C(=O)C[NH+]1CC[NH2+]CC1.
What is the InChIKey of N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide?
The InChIKey is JJEMPZXXGBIJIX-UHFFFAOYSA-P. The full InChI is InChI=1S/C8H17N3O/c1-10(2)8(12)7-11-5-3-9-4-6-11/h9H,3-7H2,1-2H3/p+2.
What are the key properties of N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide?
N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide has a molecular weight of 173.26 g/mol, XLogP of -3.46, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-piperazine-1,4-diium-1-ylacetamide is sourced from PubChem (CID 7021517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).