C40H59BrN6O4Si2 — CID 70215304
tert-butyl N-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]carbamate (PubChem CID 70215304) has the molecular formula C40H59BrN6O4Si2 and a molecular weight of 824.03 g/mol. Its IUPAC name is tert-butyl N-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 70215304 |
| Molecular Formula | C40H59BrN6O4Si2 |
| Molecular Weight | 824.03 g/mol |
| Exact Mass | 822.33 |
| IUPAC Name | tert-butyl N-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(c2nc3c(-c4ccc(-c5ccccc5)nc4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2Br)CC1 |
| InChI | InChI=1S/C40H59BrN6O4Si2/c1-40(2,3)51-39(48)44-32-18-15-30(16-19-32)36-35(41)38(46(27-49-21-23-52(4,5)6)28-50-22-24-53(7,8)9)47-37(45-36)33(26-43-47)31-17-20-34(42-25-31)29-13-11-10-12-14-29/h10-14,17,20,25-26,30,32H,15-16,18-19,21-24,27-28H2,1-9H3,(H,44,48) |
| InChIKey | XLNKIPYOEYVTFP-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.03 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|