C40H55BrFN5O4Si2 — CID 70215425
ethyl 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-2-fluorospiro[2.5]octane-2-carboxylate (PubChem CID 70215425) has the molecular formula C40H55BrFN5O4Si2 and a molecular weight of 824.98 g/mol. Its IUPAC name is ethyl 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-2-fluorospiro[2.5]octane-2-carboxylate.
| Compound Name | ethyl 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-2-fluorospiro[2.5]octane-2-carboxylate |
|---|---|
| PubChem CID | 70215425 |
| Molecular Formula | C40H55BrFN5O4Si2 |
| Molecular Weight | 824.98 g/mol |
| Exact Mass | 823.30 |
| IUPAC Name | ethyl 6-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-2-fluorospiro[2.5]octane-2-carboxylate |
| SMILES | CCOC(=O)C1(F)CC12CCC(c1nc3c(-c4ccc(-c5ccccc5)nc4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c1Br)CC2 |
| InChI | InChI=1S/C40H55BrFN5O4Si2/c1-8-51-38(48)40(42)26-39(40)18-16-30(17-19-39)35-34(41)37(46(27-49-20-22-52(2,3)4)28-50-21-23-53(5,6)7)47-36(45-35)32(25-44-47)31-14-15-33(43-24-31)29-12-10-9-11-13-29/h9-15,24-25,30H,8,16-23,26-28H2,1-7H3 |
| InChIKey | PHZJHJJZFLMDOC-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 91.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.98 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|