C22H19F3N4O8 — CID 70215949
(3S,6R,10R)-8-[(E)-[1-(3-nitrophenyl)-2-oxopyrrolidin-3-ylidene]methyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 70215949) has the molecular formula C22H19F3N4O8 and a molecular weight of 524.41 g/mol. Its IUPAC name is (3S,6R,10R)-8-[(E)-[1-(3-nitrophenyl)-2-oxopyrrolidin-3-ylidene]methyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (3S,6R,10R)-8-[(E)-[1-(3-nitrophenyl)-2-oxopyrrolidin-3-ylidene]methyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70215949 |
| Molecular Formula | C22H19F3N4O8 |
| Molecular Weight | 524.41 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | (3S,6R,10R)-8-[(E)-[1-(3-nitrophenyl)-2-oxopyrrolidin-3-ylidene]methyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C1=C(/C=C2\CCN(c3cccc([N+](=O)[O-])c3)C2=O)C[C@@H]2CN[C@@H]3C(=O)N1[C@H]23 |
| InChI | InChI=1S/C20H18N4O6.C2HF3O2/c25-18-10(4-5-22(18)13-2-1-3-14(8-13)24(29)30)6-11-7-12-9-21-15-16(12)23(19(15)26)17(11)20(27)28;3-2(4,5)1(6)7/h1-3,6,8,12,15-16,21H,4-5,7,9H2,(H,27,28);(H,6,7)/b10-6+;/t12-,15+,16-;/m1./s1 |
| InChIKey | HMAJAQRPQAQANJ-CLZQRAPGSA-N |
| XLogP | 1.43 |
| TPSA | 170.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|