C16H17N5O2S — CID 70215965
7-[5-(aminomethyl)thiophen-2-yl]oxy-N-carbamimidoyl-N-methyl-1H-indole-2-carboxamide (PubChem CID 70215965) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 7-[5-(aminomethyl)thiophen-2-yl]oxy-N-carbamimidoyl-N-methyl-1H-indole-2-carboxamide.
| Compound Name | 7-[5-(aminomethyl)thiophen-2-yl]oxy-N-carbamimidoyl-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70215965 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 7-[5-(aminomethyl)thiophen-2-yl]oxy-N-carbamimidoyl-N-methyl-1H-indole-2-carboxamide |
| SMILES | [H]/N=C(\N)N(C)C(=O)c1cc2cccc(Oc3ccc(CN)s3)c2[nH]1 |
| InChI | InChI=1S/C16H17N5O2S/c1-21(16(18)19)15(22)11-7-9-3-2-4-12(14(9)20-11)23-13-6-5-10(8-17)24-13/h2-7,20H,8,17H2,1H3,(H3,18,19) |
| InChIKey | NTFXAIDYOMGOFI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|