C37H44N2O9 — CID 70216023
[1-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-2-oxo-2-phenylmethoxyethyl] 2,2-dimethylpropanoate (PubChem CID 70216023) has the molecular formula C37H44N2O9 and a molecular weight of 660.76 g/mol. Its IUPAC name is [1-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-2-oxo-2-phenylmethoxyethyl] 2,2-dimethylpropanoate.
| Compound Name | [1-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-2-oxo-2-phenylmethoxyethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 70216023 |
| Molecular Formula | C37H44N2O9 |
| Molecular Weight | 660.76 g/mol |
| Exact Mass | 660.30 |
| IUPAC Name | [1-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-2-oxo-2-phenylmethoxyethyl] 2,2-dimethylpropanoate |
| SMILES | COc1cccc(C(=O)N(C(=O)OC(OC(=O)C(C)(C)C)C(=O)OCc2ccccc2)N(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)c1C |
| InChI | InChI=1S/C37H44N2O9/c1-23-19-24(2)21-27(20-23)30(40)39(37(7,8)9)38(31(41)28-17-14-18-29(45-10)25(28)3)35(44)48-33(47-34(43)36(4,5)6)32(42)46-22-26-15-12-11-13-16-26/h11-21,33H,22H2,1-10H3 |
| InChIKey | IFAZBLJXZFSJKA-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.76 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|