About 6-bromo-3,3-dimethyl-2H-inden-1-imine
6-bromo-3,3-dimethyl-2H-inden-1-imine (PubChem CID 70216126) has the molecular formula C11H12BrN
and a molecular weight of 238.13 g/mol. Its IUPAC name is 6-bromo-3,3-dimethyl-2H-inden-1-imine.
Molecular Properties
| Compound Name | 6-bromo-3,3-dimethyl-2H-inden-1-imine |
| PubChem CID | 70216126 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 6-bromo-3,3-dimethyl-2H-inden-1-imine |
| SMILES | [H]/N=C1\CC(C)(C)c2ccc(Br)cc21 |
| InChI | InChI=1S/C11H12BrN/c1-11(2)6-10(13)8-5-7(12)3-4-9(8)11/h3-5,13H,6H2,1-2H3/b13-10+ |
| InChIKey | PZFCEDKXTKLEHD-JLHYYAGUSA-N |
| XLogP | 3.50 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3,3-dimethyl-2H-inden-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3,3-dimethyl-2H-inden-1-imine?
The IUPAC name of 6-bromo-3,3-dimethyl-2H-inden-1-imine (CID 70216126) is 6-bromo-3,3-dimethyl-2H-inden-1-imine.
What is the SMILES notation for 6-bromo-3,3-dimethyl-2H-inden-1-imine?
The canonical SMILES for 6-bromo-3,3-dimethyl-2H-inden-1-imine is [H]/N=C1\CC(C)(C)c2ccc(Br)cc21.
What is the InChIKey of 6-bromo-3,3-dimethyl-2H-inden-1-imine?
The InChIKey is PZFCEDKXTKLEHD-JLHYYAGUSA-N. The full InChI is InChI=1S/C11H12BrN/c1-11(2)6-10(13)8-5-7(12)3-4-9(8)11/h3-5,13H,6H2,1-2H3/b13-10+.
What are the key properties of 6-bromo-3,3-dimethyl-2H-inden-1-imine?
6-bromo-3,3-dimethyl-2H-inden-1-imine has a molecular weight of 238.13 g/mol, XLogP of 3.50, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3,3-dimethyl-2H-inden-1-imine is sourced from PubChem (CID 70216126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).