C6H13NO3 — CID 70216582
(2S,3S,4S)-1-methylpiperidine-2,3,4-triol (PubChem CID 70216582) has the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. Its IUPAC name is (2S,3S,4S)-1-methylpiperidine-2,3,4-triol.
| Compound Name | (2S,3S,4S)-1-methylpiperidine-2,3,4-triol |
|---|---|
| PubChem CID | 70216582 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | (2S,3S,4S)-1-methylpiperidine-2,3,4-triol |
| SMILES | CN1CC[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO3/c1-7-3-2-4(8)5(9)6(7)10/h4-6,8-10H,2-3H2,1H3/t4-,5-,6-/m0/s1 |
| InChIKey | VVAQUGLBAVEBFZ-ZLUOBGJFSA-N |
| XLogP | -1.64 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |