C23H28N4O2 — CID 70216652
2-[(4E)-8-(2-aminopyrimidin-5-yl)-3,6-dihydro-2H-1-benzoxocin-4-yl]-1-(4-methylpiperidin-1-yl)ethanone (PubChem CID 70216652) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-[(4E)-8-(2-aminopyrimidin-5-yl)-3,6-dihydro-2H-1-benzoxocin-4-yl]-1-(4-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-[(4E)-8-(2-aminopyrimidin-5-yl)-3,6-dihydro-2H-1-benzoxocin-4-yl]-1-(4-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 70216652 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-[(4E)-8-(2-aminopyrimidin-5-yl)-3,6-dihydro-2H-1-benzoxocin-4-yl]-1-(4-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCN(C(=O)C/C2=C/Cc3cc(-c4cnc(N)nc4)ccc3OCC2)CC1 |
| InChI | InChI=1S/C23H28N4O2/c1-16-6-9-27(10-7-16)22(28)12-17-2-3-19-13-18(4-5-21(19)29-11-8-17)20-14-25-23(24)26-15-20/h2,4-5,13-16H,3,6-12H2,1H3,(H2,24,25,26)/b17-2+ |
| InChIKey | DHGPEACFYJMRSG-LAZPYJJCSA-N |
| XLogP | 3.63 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|