C31H46BrN7O4SSi2 — CID 70217083
6-bromo-5-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(1-phenylpyrazol-4-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 70217083) has the molecular formula C31H46BrN7O4SSi2 and a molecular weight of 748.90 g/mol. Its IUPAC name is 6-bromo-5-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(1-phenylpyrazol-4-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-bromo-5-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(1-phenylpyrazol-4-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 70217083 |
| Molecular Formula | C31H46BrN7O4SSi2 |
| Molecular Weight | 748.90 g/mol |
| Exact Mass | 747.21 |
| IUPAC Name | 6-bromo-5-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(1-phenylpyrazol-4-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1c(Br)c(N2CCS(=O)(=O)CC2)nc2c(-c3cnn(-c4ccccc4)c3)cnn12 |
| InChI | InChI=1S/C31H46BrN7O4SSi2/c1-45(2,3)18-14-42-23-37(24-43-15-19-46(4,5)6)31-28(32)30(36-12-16-44(40,41)17-13-36)35-29-27(21-34-39(29)31)25-20-33-38(22-25)26-10-8-7-9-11-26/h7-11,20-22H,12-19,23-24H2,1-6H3 |
| InChIKey | ZQKOHAREYAACCT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 107.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.90 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|