C33H47N5O7 — CID 70217104
tert-butyl N-[(1S,4R,6S,7Z,14S,18R)-4-[[2-(benzylamino)-2-oxoethyl]carbamoyl]-18-methoxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate (PubChem CID 70217104) has the molecular formula C33H47N5O7 and a molecular weight of 625.77 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6S,7Z,14S,18R)-4-[[2-(benzylamino)-2-oxoethyl]carbamoyl]-18-methoxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6S,7Z,14S,18R)-4-[[2-(benzylamino)-2-oxoethyl]carbamoyl]-18-methoxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
|---|---|
| PubChem CID | 70217104 |
| Molecular Formula | C33H47N5O7 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.35 |
| IUPAC Name | tert-butyl N-[(1S,4R,6S,7Z,14S,18R)-4-[[2-(benzylamino)-2-oxoethyl]carbamoyl]-18-methoxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]carbamate |
| SMILES | CO[C@@H]1C[C@H]2C(=O)N[C@]3(C(=O)NCC(=O)NCc4ccccc4)C[C@H]3/C=C\CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N2C1 |
| InChI | InChI=1S/C33H47N5O7/c1-32(2,3)45-31(43)36-25-16-12-7-5-6-11-15-23-18-33(23,37-28(40)26-17-24(44-4)21-38(26)29(25)41)30(42)35-20-27(39)34-19-22-13-9-8-10-14-22/h8-11,13-15,23-26H,5-7,12,16-21H2,1-4H3,(H,34,39)(H,35,42)(H,36,43)(H,37,40)/b15-11-/t23-,24-,25+,26+,33-/m1/s1 |
| InChIKey | WVOKLYYZXNUPNU-DTEQRHRCSA-N |
| XLogP | 2.32 |
| TPSA | 155.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|