About N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide
N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide (PubChem CID 70217179) has the molecular formula C10H11N5O2
and a molecular weight of 233.23 g/mol. Its IUPAC name is N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide |
| PubChem CID | 70217179 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(-n2cnc(C)n2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H11N5O2/c1-6-11-5-15(14-6)8-3-4-9(12-7(2)16)13-10(8)17/h3-5H,1-2H3,(H2,12,13,16,17) |
| InChIKey | TUGHAJSFQDGMKR-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide?
The IUPAC name of N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide (CID 70217179) is N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide.
What is the SMILES notation for N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide?
The canonical SMILES for N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide is CC(=O)Nc1ccc(-n2cnc(C)n2)c(=O)[nH]1.
What is the InChIKey of N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide?
The InChIKey is TUGHAJSFQDGMKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O2/c1-6-11-5-15(14-6)8-3-4-9(12-7(2)16)13-10(8)17/h3-5H,1-2H3,(H2,12,13,16,17).
What are the key properties of N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide?
N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide has a molecular weight of 233.23 g/mol, XLogP of 0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(3-methyl-1,2,4-triazol-1-yl)-6-oxo-1H-pyridin-2-yl]acetamide is sourced from PubChem (CID 70217179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).