C19H19F2N3O2S — CID 70217301
prop-2-enyl 2-[3-amino-1-(1,3-difluoropropan-2-yl)indol-5-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 70217301) has the molecular formula C19H19F2N3O2S and a molecular weight of 391.44 g/mol. Its IUPAC name is prop-2-enyl 2-[3-amino-1-(1,3-difluoropropan-2-yl)indol-5-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-[3-amino-1-(1,3-difluoropropan-2-yl)indol-5-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 70217301 |
| Molecular Formula | C19H19F2N3O2S |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | prop-2-enyl 2-[3-amino-1-(1,3-difluoropropan-2-yl)indol-5-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1sc(-c2ccc3c(c2)c(N)cn3C(CF)CF)nc1C |
| InChI | InChI=1S/C19H19F2N3O2S/c1-3-6-26-19(25)17-11(2)23-18(27-17)12-4-5-16-14(7-12)15(22)10-24(16)13(8-20)9-21/h3-5,7,10,13H,1,6,8-9,22H2,2H3 |
| InChIKey | LKHCKTYQGCYBKT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|