C35H50BrN5O4Si2 — CID 70217408
2-[3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]acetic acid (PubChem CID 70217408) has the molecular formula C35H50BrN5O4Si2 and a molecular weight of 740.89 g/mol. Its IUPAC name is 2-[3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]acetic acid.
| Compound Name | 2-[3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 70217408 |
| Molecular Formula | C35H50BrN5O4Si2 |
| Molecular Weight | 740.89 g/mol |
| Exact Mass | 739.26 |
| IUPAC Name | 2-[3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]acetic acid |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1c(Br)c(C2CCCC(CC(=O)O)C2)nc2c(-c3cnc4ccccc4c3)cnn12 |
| InChI | InChI=1S/C35H50BrN5O4Si2/c1-46(2,3)16-14-44-23-40(24-45-15-17-47(4,5)6)35-32(36)33(27-12-9-10-25(18-27)19-31(42)43)39-34-29(22-38-41(34)35)28-20-26-11-7-8-13-30(26)37-21-28/h7-8,11,13,20-22,25,27H,9-10,12,14-19,23-24H2,1-6H3,(H,42,43) |
| InChIKey | VCNVNCABFLNHCE-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.89 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|