C37H53ClN6O4Si2 — CID 70217487
tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-chloro-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 70217487) has the molecular formula C37H53ClN6O4Si2 and a molecular weight of 737.49 g/mol. Its IUPAC name is tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-chloro-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-chloro-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 70217487 |
| Molecular Formula | C37H53ClN6O4Si2 |
| Molecular Weight | 737.49 g/mol |
| Exact Mass | 736.34 |
| IUPAC Name | tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-chloro-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2nc3c(-c4cnc5ccccc5c4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2Cl)CC1 |
| InChI | InChI=1S/C37H53ClN6O4Si2/c1-37(2,3)48-36(45)42-16-14-27(15-17-42)33-32(38)35(43(25-46-18-20-49(4,5)6)26-47-19-21-50(7,8)9)44-34(41-33)30(24-40-44)29-22-28-12-10-11-13-31(28)39-23-29/h10-14,22-24H,15-21,25-26H2,1-9H3 |
| InChIKey | JCSWMVVRWAHFLN-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 94.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.49 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|