C42H63N7O3Si3 — CID 70217553
3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)-5-[4-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]cyclohexen-1-yl]pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 70217553) has the molecular formula C42H63N7O3Si3 and a molecular weight of 798.27 g/mol. Its IUPAC name is 3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)-5-[4-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]cyclohexen-1-yl]pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)-5-[4-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]cyclohexen-1-yl]pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 70217553 |
| Molecular Formula | C42H63N7O3Si3 |
| Molecular Weight | 798.27 g/mol |
| Exact Mass | 797.43 |
| IUPAC Name | 3-quinolin-3-yl-N,N-bis(2-trimethylsilylethoxymethyl)-5-[4-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]cyclohexen-1-yl]pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2=CCC(c3cnn(COCC[Si](C)(C)C)c3)CC2)nc2c(-c3cnc4ccccc4c3)cnn12 |
| InChI | InChI=1S/C42H63N7O3Si3/c1-53(2,3)21-18-50-30-47(31-51-19-22-54(4,5)6)41-25-40(46-42-38(28-45-49(41)42)36-24-35-12-10-11-13-39(35)43-26-36)34-16-14-33(15-17-34)37-27-44-48(29-37)32-52-20-23-55(7,8)9/h10-13,16,24-29,33H,14-15,17-23,30-32H2,1-9H3 |
| InChIKey | YHSXAPVSOFDXAY-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.27 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|