About CID 70219177
CID 70219177 (PubChem CID 70219177) has the molecular formula C24H29N5O3
and a molecular weight of 435.53 g/mol.
Molecular Properties
| Compound Name | CID 70219177 |
| PubChem CID | 70219177 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(C3CC3)cc1C21N=C(N)N(Cc2nnc(C)o2)C1=O |
| InChI | InChI=1S/C24H29N5O3/c1-14-27-28-20(32-14)13-29-21(30)24(26-22(29)25)19-11-16(15-3-4-15)5-6-17(19)12-23(24)9-7-18(31-2)8-10-23/h5-6,11,15,18H,3-4,7-10,12-13H2,1-2H3,(H2,25,26) |
| InChIKey | ZPCHRBPOLSJGJT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 70219177 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70219177?
The IUPAC name of CID 70219177 (CID 70219177) is not available.
What is the SMILES notation for CID 70219177?
The canonical SMILES for CID 70219177 is COC1CCC2(CC1)Cc1ccc(C3CC3)cc1C21N=C(N)N(Cc2nnc(C)o2)C1=O.
What is the InChIKey of CID 70219177?
The InChIKey is ZPCHRBPOLSJGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N5O3/c1-14-27-28-20(32-14)13-29-21(30)24(26-22(29)25)19-11-16(15-3-4-15)5-6-17(19)12-23(24)9-7-18(31-2)8-10-23/h5-6,11,15,18H,3-4,7-10,12-13H2,1-2H3,(H2,25,26).
What are the key properties of CID 70219177?
CID 70219177 has a molecular weight of 435.53 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70219177 is sourced from PubChem (CID 70219177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).