About (5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene
(5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene (PubChem CID 70219242) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is (5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | (5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene |
| PubChem CID | 70219242 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene |
| SMILES | CC[C@H]1C=C(OC)C=C(OC)C1 |
| InChI | InChI=1S/C10H16O2/c1-4-8-5-9(11-2)7-10(6-8)12-3/h5,7-8H,4,6H2,1-3H3/t8-/m0/s1 |
| InChIKey | ZXNFLMCMZNQUSV-QMMMGPOBSA-N |
| XLogP | 2.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene?
The IUPAC name of (5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene (CID 70219242) is (5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene.
What is the SMILES notation for (5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene?
The canonical SMILES for (5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene is CC[C@H]1C=C(OC)C=C(OC)C1.
What is the InChIKey of (5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene?
The InChIKey is ZXNFLMCMZNQUSV-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H16O2/c1-4-8-5-9(11-2)7-10(6-8)12-3/h5,7-8H,4,6H2,1-3H3/t8-/m0/s1.
What are the key properties of (5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene?
(5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene has a molecular weight of 168.24 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-ethyl-1,3-dimethoxycyclohexa-1,3-diene is sourced from PubChem (CID 70219242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).