About 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid
4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid (PubChem CID 70219301) has the molecular formula C5H6N2O3
and a molecular weight of 142.11 g/mol. Its IUPAC name is 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid |
| PubChem CID | 70219301 |
| Molecular Formula | C5H6N2O3 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid |
| SMILES | O=C1C=CNC(C(=O)O)N1 |
| InChI | InChI=1S/C5H6N2O3/c8-3-1-2-6-4(7-3)5(9)10/h1-2,4,6H,(H,7,8)(H,9,10) |
| InChIKey | CYMFIUONAOOPRF-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid?
The IUPAC name of 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid (CID 70219301) is 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid.
What is the SMILES notation for 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid?
The canonical SMILES for 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid is O=C1C=CNC(C(=O)O)N1.
What is the InChIKey of 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid?
The InChIKey is CYMFIUONAOOPRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3/c8-3-1-2-6-4(7-3)5(9)10/h1-2,4,6H,(H,7,8)(H,9,10).
What are the key properties of 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid?
4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid has a molecular weight of 142.11 g/mol, XLogP of -1.37, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid is sourced from PubChem (CID 70219301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).