4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid

C5H6N2O3 — CID 70219301

IUPAC4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid
SMILESO=C1C=CNC(C(=O)O)N1
InChIInChI=1S/C5H6N2O3/c8-3-1-2-6-4(7-3)5(9)10/h1-2,4,6H,(H,7,8)(H,9,10)
InChIKeyCYMFIUONAOOPRF-UHFFFAOYSA-N
MW142.11 g/mol
LogP-1.37
Rot. Bonds1

About 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid

4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid (PubChem CID 70219301) has the molecular formula C5H6N2O3 and a molecular weight of 142.11 g/mol. Its IUPAC name is 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid.

Molecular Properties

Compound Name4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid
PubChem CID70219301
Molecular FormulaC5H6N2O3
Molecular Weight142.11 g/mol
Exact Mass142.04
IUPAC Name4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid
SMILESO=C1C=CNC(C(=O)O)N1
InChIInChI=1S/C5H6N2O3/c8-3-1-2-6-4(7-3)5(9)10/h1-2,4,6H,(H,7,8)(H,9,10)
InChIKeyCYMFIUONAOOPRF-UHFFFAOYSA-N
XLogP-1.37
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.11
LogP ≤ 5-1.37
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid?
The IUPAC name of 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid (CID 70219301) is 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid.
What is the SMILES notation for 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid?
The canonical SMILES for 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid is O=C1C=CNC(C(=O)O)N1.
What is the InChIKey of 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid?
The InChIKey is CYMFIUONAOOPRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3/c8-3-1-2-6-4(7-3)5(9)10/h1-2,4,6H,(H,7,8)(H,9,10).
What are the key properties of 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid?
4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid has a molecular weight of 142.11 g/mol, XLogP of -1.37, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-2,3-dihydro-1H-pyrimidine-2-carboxylic acid is sourced from PubChem (CID 70219301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).