C16H18BrN2P — CID 70219619
(2'Z)-6-bromo-2'-(1-phosphanylethylidene)spiro[3H-indene-2,4'-cyclohexane]-1,1'-diimine (PubChem CID 70219619) has the molecular formula C16H18BrN2P and a molecular weight of 349.21 g/mol. Its IUPAC name is (2'Z)-6-bromo-2'-(1-phosphanylethylidene)spiro[3H-indene-2,4'-cyclohexane]-1,1'-diimine.
| Compound Name | (2'Z)-6-bromo-2'-(1-phosphanylethylidene)spiro[3H-indene-2,4'-cyclohexane]-1,1'-diimine |
|---|---|
| PubChem CID | 70219619 |
| Molecular Formula | C16H18BrN2P |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | (2'Z)-6-bromo-2'-(1-phosphanylethylidene)spiro[3H-indene-2,4'-cyclohexane]-1,1'-diimine |
| SMILES | [H]/N=C1\c2cc(Br)ccc2CC12CCC(=N\[H])/C(=C(/C)P)C2 |
| InChI | InChI=1S/C16H18BrN2P/c1-9(20)13-8-16(5-4-14(13)18)7-10-2-3-11(17)6-12(10)15(16)19/h2-3,6,18-19H,4-5,7-8,20H2,1H3/b13-9-,18-14+,19-15+ |
| InChIKey | KLMOJIKXKRDKLG-ORZJXCINSA-N |
| XLogP | 4.71 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|