About 5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one
5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one (PubChem CID 70220005) has the molecular formula C15H16FIO2
and a molecular weight of 374.19 g/mol. Its IUPAC name is 5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one.
Molecular Properties
| Compound Name | 5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one |
| PubChem CID | 70220005 |
| Molecular Formula | C15H16FIO2 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one |
| SMILES | COC1CCC2(CC1)Cc1cc(F)c(I)cc1C2=O |
| InChI | InChI=1S/C15H16FIO2/c1-19-10-2-4-15(5-3-10)8-9-6-12(16)13(17)7-11(9)14(15)18/h6-7,10H,2-5,8H2,1H3 |
| InChIKey | SPNWUIAGUSONFO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
The IUPAC name of 5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one (CID 70220005) is 5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one.
What is the SMILES notation for 5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
The canonical SMILES for 5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one is COC1CCC2(CC1)Cc1cc(F)c(I)cc1C2=O.
What is the InChIKey of 5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
The InChIKey is SPNWUIAGUSONFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FIO2/c1-19-10-2-4-15(5-3-10)8-9-6-12(16)13(17)7-11(9)14(15)18/h6-7,10H,2-5,8H2,1H3.
What are the key properties of 5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one has a molecular weight of 374.19 g/mol, XLogP of 3.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-iodo-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one is sourced from PubChem (CID 70220005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).