C20H29FO2 — CID 70220681
(8R,9S,10R,13S,14S,17S)-2-fluoro-17-(1-hydroxyethyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 70220681) has the molecular formula C20H29FO2 and a molecular weight of 320.45 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-2-fluoro-17-(1-hydroxyethyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S,17S)-2-fluoro-17-(1-hydroxyethyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70220681 |
| Molecular Formula | C20H29FO2 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-2-fluoro-17-(1-hydroxyethyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C(F)C[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H29FO2/c1-11(22)16-5-6-17-14-4-3-12-9-19(23)18(21)10-15(12)13(14)7-8-20(16,17)2/h9,11,13-18,22H,3-8,10H2,1-2H3/t11?,13-,14+,15-,16+,17-,18?,20+/m0/s1 |
| InChIKey | ZHNAHDZLNJZFJK-JTPUNJKGSA-N |
| XLogP | 4.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |