C22H21N3O3S — CID 70220999
2-[3-amino-1-(2-phenylmethoxyethyl)indol-5-yl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 70220999) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-[3-amino-1-(2-phenylmethoxyethyl)indol-5-yl]-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[3-amino-1-(2-phenylmethoxyethyl)indol-5-yl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 70220999 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-[3-amino-1-(2-phenylmethoxyethyl)indol-5-yl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(-c2ccc3c(c2)c(N)cn3CCOCc2ccccc2)sc1C(=O)O |
| InChI | InChI=1S/C22H21N3O3S/c1-14-20(22(26)27)29-21(24-14)16-7-8-19-17(11-16)18(23)12-25(19)9-10-28-13-15-5-3-2-4-6-15/h2-8,11-12H,9-10,13,23H2,1H3,(H,26,27) |
| InChIKey | AFHAWJCOKGVMCU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|