About 4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine
4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine (PubChem CID 70221610) has the molecular formula C21H22BrN
and a molecular weight of 368.32 g/mol. Its IUPAC name is 4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine.
Molecular Properties
| Compound Name | 4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine |
| PubChem CID | 70221610 |
| Molecular Formula | C21H22BrN |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine |
| SMILES | [H]/N=C1\c2cc(Br)ccc2CC12CCC(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C21H22BrN/c22-18-7-6-17-14-21(20(23)19(17)13-18)10-8-16(9-11-21)12-15-4-2-1-3-5-15/h1-7,13,16,23H,8-12,14H2/b23-20+ |
| InChIKey | DHZQOPKKJKIFMU-BSYVCWPDSA-N |
| XLogP | 5.79 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine?
The IUPAC name of 4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine (CID 70221610) is 4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine.
What is the SMILES notation for 4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine?
The canonical SMILES for 4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine is [H]/N=C1\c2cc(Br)ccc2CC12CCC(Cc1ccccc1)CC2.
What is the InChIKey of 4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine?
The InChIKey is DHZQOPKKJKIFMU-BSYVCWPDSA-N. The full InChI is InChI=1S/C21H22BrN/c22-18-7-6-17-14-21(20(23)19(17)13-18)10-8-16(9-11-21)12-15-4-2-1-3-5-15/h1-7,13,16,23H,8-12,14H2/b23-20+.
What are the key properties of 4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine?
4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine has a molecular weight of 368.32 g/mol, XLogP of 5.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-benzyl-6-bromospiro[3H-indene-2,1'-cyclohexane]-1-imine is sourced from PubChem (CID 70221610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).