C23H34F2N2O3 — CID 70221928
tert-butyl 3-[4,6-difluoro-1-(3-methoxypropyl)-3-methyl-2,3-dihydroindol-2-yl]piperidine-1-carboxylate (PubChem CID 70221928) has the molecular formula C23H34F2N2O3 and a molecular weight of 424.53 g/mol. Its IUPAC name is tert-butyl 3-[4,6-difluoro-1-(3-methoxypropyl)-3-methyl-2,3-dihydroindol-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4,6-difluoro-1-(3-methoxypropyl)-3-methyl-2,3-dihydroindol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70221928 |
| Molecular Formula | C23H34F2N2O3 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | tert-butyl 3-[4,6-difluoro-1-(3-methoxypropyl)-3-methyl-2,3-dihydroindol-2-yl]piperidine-1-carboxylate |
| SMILES | COCCCN1c2cc(F)cc(F)c2C(C)C1C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H34F2N2O3/c1-15-20-18(25)12-17(24)13-19(20)27(10-7-11-29-5)21(15)16-8-6-9-26(14-16)22(28)30-23(2,3)4/h12-13,15-16,21H,6-11,14H2,1-5H3 |
| InChIKey | RKDVEHFYSWQKQC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|