C23H27N7O3 — CID 70222820
(2R,3S)-3-[[8-ethyl-4-[(4-pyridin-3-ylphenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]butane-1,2,4-triol (PubChem CID 70222820) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is (2R,3S)-3-[[8-ethyl-4-[(4-pyridin-3-ylphenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]butane-1,2,4-triol.
| Compound Name | (2R,3S)-3-[[8-ethyl-4-[(4-pyridin-3-ylphenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]butane-1,2,4-triol |
|---|---|
| PubChem CID | 70222820 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (2R,3S)-3-[[8-ethyl-4-[(4-pyridin-3-ylphenyl)methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]butane-1,2,4-triol |
| SMILES | CCc1cnn2c(NCc3ccc(-c4cccnc4)cc3)nc(N[C@@H](CO)[C@@H](O)CO)nc12 |
| InChI | InChI=1S/C23H27N7O3/c1-2-16-12-26-30-21(16)28-22(27-19(13-31)20(33)14-32)29-23(30)25-10-15-5-7-17(8-6-15)18-4-3-9-24-11-18/h3-9,11-12,19-20,31-33H,2,10,13-14H2,1H3,(H2,25,27,28,29)/t19-,20-/m0/s1 |
| InChIKey | CHFNSVLRWUMBGX-PMACEKPBSA-N |
| XLogP | 1.49 |
| TPSA | 140.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |