C17H28IN — CID 70222965
1-[1-(4-iodocyclohexa-1,5-dien-1-yl)cyclobutyl]-N,N,3-trimethylbutan-1-amine (PubChem CID 70222965) has the molecular formula C17H28IN and a molecular weight of 373.32 g/mol. Its IUPAC name is 1-[1-(4-iodocyclohexa-1,5-dien-1-yl)cyclobutyl]-N,N,3-trimethylbutan-1-amine.
| Compound Name | 1-[1-(4-iodocyclohexa-1,5-dien-1-yl)cyclobutyl]-N,N,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 70222965 |
| Molecular Formula | C17H28IN |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-[1-(4-iodocyclohexa-1,5-dien-1-yl)cyclobutyl]-N,N,3-trimethylbutan-1-amine |
| SMILES | CC(C)CC(N(C)C)C1(C2=CCC(I)C=C2)CCC1 |
| InChI | InChI=1S/C17H28IN/c1-13(2)12-16(19(3)4)17(10-5-11-17)14-6-8-15(18)9-7-14/h6-8,13,15-16H,5,9-12H2,1-4H3 |
| InChIKey | MHZGTUHUZRDDBC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|