C22H30O2 — CID 70223410
ethyl 3-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]prop-2-enoate (PubChem CID 70223410) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is ethyl 3-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]prop-2-enoate.
| Compound Name | ethyl 3-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]prop-2-enoate |
|---|---|
| PubChem CID | 70223410 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | ethyl 3-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]prop-2-enoate |
| SMILES | CCOC(=O)C=CC1CC1c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C22H30O2/c1-6-24-20(23)10-8-15-13-17(15)16-7-9-18-19(14-16)22(4,5)12-11-21(18,2)3/h7-10,14-15,17H,6,11-13H2,1-5H3 |
| InChIKey | GUVYFNCWJSDIQY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|