C12H17ClN2O — CID 70223731
3-(2-chloroethyl)-2-ethyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 70223731) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 3-(2-chloroethyl)-2-ethyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-(2-chloroethyl)-2-ethyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 70223731 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 3-(2-chloroethyl)-2-ethyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCc1nc2n(c(=O)c1CCCl)CCCC2 |
| InChI | InChI=1S/C12H17ClN2O/c1-2-10-9(6-7-13)12(16)15-8-4-3-5-11(15)14-10/h2-8H2,1H3 |
| InChIKey | QXNIVXCVTFGNGB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|