C17H21N3S — CID 70223787
1-N,1-N,2-N,2-N,10-pentamethylphenothiazine-1,2-diamine (PubChem CID 70223787) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N,10-pentamethylphenothiazine-1,2-diamine.
| Compound Name | 1-N,1-N,2-N,2-N,10-pentamethylphenothiazine-1,2-diamine |
|---|---|
| PubChem CID | 70223787 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-N,1-N,2-N,2-N,10-pentamethylphenothiazine-1,2-diamine |
| SMILES | CN(C)c1ccc2c(c1N(C)C)N(C)c1ccccc1S2 |
| InChI | InChI=1S/C17H21N3S/c1-18(2)13-10-11-15-17(16(13)19(3)4)20(5)12-8-6-7-9-14(12)21-15/h6-11H,1-5H3 |
| InChIKey | GVAMQSGCSDDWKX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |