About benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate
benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate (PubChem CID 7022411) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate |
| PubChem CID | 7022411 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate |
| SMILES | O=C(N[C@H](CO)CCO)OCc1ccccc1 |
| InChI | InChI=1S/C12H17NO4/c14-7-6-11(8-15)13-12(16)17-9-10-4-2-1-3-5-10/h1-5,11,14-15H,6-9H2,(H,13,16)/t11-/m0/s1 |
| InChIKey | UZEHYMIWBJBOPW-NSHDSACASA-N |
| XLogP | 0.66 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate?
The IUPAC name of benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate (CID 7022411) is benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate.
What is the SMILES notation for benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate?
The canonical SMILES for benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate is O=C(N[C@H](CO)CCO)OCc1ccccc1.
What is the InChIKey of benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate?
The InChIKey is UZEHYMIWBJBOPW-NSHDSACASA-N. The full InChI is InChI=1S/C12H17NO4/c14-7-6-11(8-15)13-12(16)17-9-10-4-2-1-3-5-10/h1-5,11,14-15H,6-9H2,(H,13,16)/t11-/m0/s1.
What are the key properties of benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate?
benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate has a molecular weight of 239.27 g/mol, XLogP of 0.66, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(2S)-1,4-dihydroxybutan-2-yl]carbamate is sourced from PubChem (CID 7022411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).