C10H14NO6P — CID 70224373
(4R,5S)-5-(1,3,2-dioxaphosphetan-2-yl)-4-(morpholine-4-carbonyl)oxolan-2-one (PubChem CID 70224373) has the molecular formula C10H14NO6P and a molecular weight of 275.20 g/mol. Its IUPAC name is (4R,5S)-5-(1,3,2-dioxaphosphetan-2-yl)-4-(morpholine-4-carbonyl)oxolan-2-one.
| Compound Name | (4R,5S)-5-(1,3,2-dioxaphosphetan-2-yl)-4-(morpholine-4-carbonyl)oxolan-2-one |
|---|---|
| PubChem CID | 70224373 |
| Molecular Formula | C10H14NO6P |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (4R,5S)-5-(1,3,2-dioxaphosphetan-2-yl)-4-(morpholine-4-carbonyl)oxolan-2-one |
| SMILES | O=C1C[C@H](C(=O)N2CCOCC2)[C@H](P2OCO2)O1 |
| InChI | InChI=1S/C10H14NO6P/c12-8-5-7(10(17-8)18-15-6-16-18)9(13)11-1-3-14-4-2-11/h7,10H,1-6H2/t7-,10+/m1/s1 |
| InChIKey | NXLRDZGHMKEMSK-XCBNKYQSSA-N |
| XLogP | 0.05 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|