About (2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine
(2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine (PubChem CID 70224389) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is (2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine.
Molecular Properties
| Compound Name | (2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine |
| PubChem CID | 70224389 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | (2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine |
| SMILES | CC1=NC2CC=C(CN)C=C2N1 |
| InChI | InChI=1S/C9H13N3/c1-6-11-8-3-2-7(5-10)4-9(8)12-6/h2,4,8H,3,5,10H2,1H3,(H,11,12) |
| InChIKey | ZBLMRBMTSOIPOO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine?
The IUPAC name of (2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine (CID 70224389) is (2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine.
What is the SMILES notation for (2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine?
The canonical SMILES for (2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine is CC1=NC2CC=C(CN)C=C2N1.
What is the InChIKey of (2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine?
The InChIKey is ZBLMRBMTSOIPOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-6-11-8-3-2-7(5-10)4-9(8)12-6/h2,4,8H,3,5,10H2,1H3,(H,11,12).
What are the key properties of (2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine?
(2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine has a molecular weight of 163.22 g/mol, XLogP of 0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-7,7a-dihydro-3H-benzimidazol-5-yl)methanamine is sourced from PubChem (CID 70224389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).