C16H16ClF3N2O2 — CID 70224574
(5R)-7-chloro-3-cyclopropyl-5-prop-2-enoxy-5-(trifluoromethyl)-1,4-dihydro-1,3-benzodiazepin-2-one (PubChem CID 70224574) has the molecular formula C16H16ClF3N2O2 and a molecular weight of 360.76 g/mol. Its IUPAC name is (5R)-7-chloro-3-cyclopropyl-5-prop-2-enoxy-5-(trifluoromethyl)-1,4-dihydro-1,3-benzodiazepin-2-one.
| Compound Name | (5R)-7-chloro-3-cyclopropyl-5-prop-2-enoxy-5-(trifluoromethyl)-1,4-dihydro-1,3-benzodiazepin-2-one |
|---|---|
| PubChem CID | 70224574 |
| Molecular Formula | C16H16ClF3N2O2 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (5R)-7-chloro-3-cyclopropyl-5-prop-2-enoxy-5-(trifluoromethyl)-1,4-dihydro-1,3-benzodiazepin-2-one |
| SMILES | C=CCO[C@@]1(C(F)(F)F)CN(C2CC2)C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H16ClF3N2O2/c1-2-7-24-15(16(18,19)20)9-22(11-4-5-11)14(23)21-13-6-3-10(17)8-12(13)15/h2-3,6,8,11H,1,4-5,7,9H2,(H,21,23)/t15-/m0/s1 |
| InChIKey | FURXZBWSDZCNNK-HNNXBMFYSA-N |
| XLogP | 4.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|