About 5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine
5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (PubChem CID 70225064) has the molecular formula C22H18BrN3O2S
and a molecular weight of 468.38 g/mol. Its IUPAC name is 5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| PubChem CID | 70225064 |
| Molecular Formula | C22H18BrN3O2S |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccc4c(c3)CCN4)c3cc(Br)cnc32)cc1 |
| InChI | InChI=1S/C22H18BrN3O2S/c1-14-2-5-18(6-3-14)29(27,28)26-13-20(19-11-17(23)12-25-22(19)26)15-4-7-21-16(10-15)8-9-24-21/h2-7,10-13,24H,8-9H2,1H3 |
| InChIKey | FQIOTLDJOQFDLX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine?
The IUPAC name of 5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (CID 70225064) is 5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine.
What is the SMILES notation for 5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine?
The canonical SMILES for 5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine is Cc1ccc(S(=O)(=O)n2cc(-c3ccc4c(c3)CCN4)c3cc(Br)cnc32)cc1.
What is the InChIKey of 5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine?
The InChIKey is FQIOTLDJOQFDLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18BrN3O2S/c1-14-2-5-18(6-3-14)29(27,28)26-13-20(19-11-17(23)12-25-22(19)26)15-4-7-21-16(10-15)8-9-24-21/h2-7,10-13,24H,8-9H2,1H3.
What are the key properties of 5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine?
5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine has a molecular weight of 468.38 g/mol, XLogP of 4.98, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(2,3-dihydro-1H-indol-5-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine is sourced from PubChem (CID 70225064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).