About 6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one
6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one (PubChem CID 70225326) has the molecular formula C23H27NO4
and a molecular weight of 381.47 g/mol. Its IUPAC name is 6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one.
Molecular Properties
| Compound Name | 6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one |
| PubChem CID | 70225326 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one |
| SMILES | COc1ccc(C2CN(C)C(=O)CO2)cc1OCCC1Cc2ccccc2C1 |
| InChI | InChI=1S/C23H27NO4/c1-24-14-22(28-15-23(24)25)19-7-8-20(26-2)21(13-19)27-10-9-16-11-17-5-3-4-6-18(17)12-16/h3-8,13,16,22H,9-12,14-15H2,1-2H3 |
| InChIKey | LDKYZXGOFDRHJS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one?
The IUPAC name of 6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one (CID 70225326) is 6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one.
What is the SMILES notation for 6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one?
The canonical SMILES for 6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one is COc1ccc(C2CN(C)C(=O)CO2)cc1OCCC1Cc2ccccc2C1.
What is the InChIKey of 6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one?
The InChIKey is LDKYZXGOFDRHJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO4/c1-24-14-22(28-15-23(24)25)19-7-8-20(26-2)21(13-19)27-10-9-16-11-17-5-3-4-6-18(17)12-16/h3-8,13,16,22H,9-12,14-15H2,1-2H3.
What are the key properties of 6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one?
6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one has a molecular weight of 381.47 g/mol, XLogP of 3.41, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-[2-(2,3-dihydro-1H-inden-2-yl)ethoxy]-4-methoxyphenyl]-4-methylmorpholin-3-one is sourced from PubChem (CID 70225326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).