C17H18N2 — CID 70225724
5-methylidene-1,2,3,4,6,11-hexahydroindeno[1,2-c]isoquinolin-10-amine (PubChem CID 70225724) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5-methylidene-1,2,3,4,6,11-hexahydroindeno[1,2-c]isoquinolin-10-amine.
| Compound Name | 5-methylidene-1,2,3,4,6,11-hexahydroindeno[1,2-c]isoquinolin-10-amine |
|---|---|
| PubChem CID | 70225724 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 5-methylidene-1,2,3,4,6,11-hexahydroindeno[1,2-c]isoquinolin-10-amine |
| SMILES | C=C1NC2=C(Cc3c(N)cccc32)C2=C1CCCC2 |
| InChI | InChI=1S/C17H18N2/c1-10-11-5-2-3-6-12(11)15-9-14-13(17(15)19-10)7-4-8-16(14)18/h4,7-8,19H,1-3,5-6,9,18H2 |
| InChIKey | NVJLBSFIKYDCJP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|