C29H27N3O — CID 70225810
2-acetyl-4-butyl-5-[1H-imidazol-2-yl(diphenyl)methyl]benzonitrile (PubChem CID 70225810) has the molecular formula C29H27N3O and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-acetyl-4-butyl-5-[1H-imidazol-2-yl(diphenyl)methyl]benzonitrile.
| Compound Name | 2-acetyl-4-butyl-5-[1H-imidazol-2-yl(diphenyl)methyl]benzonitrile |
|---|---|
| PubChem CID | 70225810 |
| Molecular Formula | C29H27N3O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-acetyl-4-butyl-5-[1H-imidazol-2-yl(diphenyl)methyl]benzonitrile |
| SMILES | CCCCc1cc(C(C)=O)c(C#N)cc1C(c1ccccc1)(c1ccccc1)c1ncc[nH]1 |
| InChI | InChI=1S/C29H27N3O/c1-3-4-11-22-18-26(21(2)33)23(20-30)19-27(22)29(28-31-16-17-32-28,24-12-7-5-8-13-24)25-14-9-6-10-15-25/h5-10,12-19H,3-4,11H2,1-2H3,(H,31,32) |
| InChIKey | PPTZIVMZHPFIPJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|