C18H23NO4 — CID 70226361
(3R,6S)-6-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 70226361) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is (3R,6S)-6-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3R,6S)-6-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 70226361 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (3R,6S)-6-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC1(CC[C@H]2CC3CO[C@H](c4ccccc4)N3C2=O)OCCO1 |
| InChI | InChI=1S/C18H23NO4/c1-18(22-9-10-23-18)8-7-14-11-15-12-21-17(19(15)16(14)20)13-5-3-2-4-6-13/h2-6,14-15,17H,7-12H2,1H3/t14-,15?,17+/m0/s1 |
| InChIKey | SRTKOXKTPVQMKU-XJIUDMAQSA-N |
| XLogP | 2.48 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |