About [4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine
[4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine (PubChem CID 70227326) has the molecular formula C20H20FNO
and a molecular weight of 309.38 g/mol. Its IUPAC name is [4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine.
Molecular Properties
| Compound Name | [4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine |
| PubChem CID | 70227326 |
| Molecular Formula | C20H20FNO |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine |
| SMILES | C=C(OC)c1ccc2ccc(F)c(C3=CC=C(CN)CC3)c2c1 |
| InChI | InChI=1S/C20H20FNO/c1-13(23-2)17-8-7-15-9-10-19(21)20(18(15)11-17)16-5-3-14(12-22)4-6-16/h3,5,7-11H,1,4,6,12,22H2,2H3 |
| InChIKey | ICCYTIPFMSWJML-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine?
The IUPAC name of [4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine (CID 70227326) is [4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine.
What is the SMILES notation for [4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine?
The canonical SMILES for [4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine is C=C(OC)c1ccc2ccc(F)c(C3=CC=C(CN)CC3)c2c1.
What is the InChIKey of [4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine?
The InChIKey is ICCYTIPFMSWJML-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FNO/c1-13(23-2)17-8-7-15-9-10-19(21)20(18(15)11-17)16-5-3-14(12-22)4-6-16/h3,5,7-11H,1,4,6,12,22H2,2H3.
What are the key properties of [4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine?
[4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine has a molecular weight of 309.38 g/mol, XLogP of 4.66, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-fluoro-7-(1-methoxyethenyl)naphthalen-1-yl]cyclohexa-1,3-dien-1-yl]methanamine is sourced from PubChem (CID 70227326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).